Difference between revisions of "SJ19063"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NA+ NA+] == * common-name: ** na+ * smiles: ** [na+] * inchi-key: ** fknqfgjonoiptf-uhfffaoysa-...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23-DIPHOSPHOGLYCERATE 23-DIPHOSPHOGLYCERATE] == * common-name: ** 2,3-diphospho-d-glycerate * s...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NA+ NA+] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23-DIPHOSPHOGLYCERATE 23-DIPHOSPHOGLYCERATE] ==
 
* common-name:
 
* common-name:
** na+
+
** 2,3-diphospho-d-glycerate
 
* smiles:
 
* smiles:
** [na+]
+
** c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** fknqfgjonoiptf-uhfffaoysa-n
+
** xohueycvluuejj-uwtatzphsa-i
 
* molecular-weight:
 
* molecular-weight:
** 22.99
+
** 260.998
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.6.3.9-RXN]]
+
* [[RXN-15509]]
* [[ExchangeSeed-NA+]]
+
* [[RXN-15510]]
* [[PINA1th]]
+
* [[RXN-15511]]
* [[PINA1tm]]
+
* [[RXN-15512]]
* [[TRANS-RXN-101]]
 
* [[TransportSeed-NA+]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.6.3.9-RXN]]
+
* [[BISPHOSPHOGLYCERATE-MUTASE-RXN]]
* [[ExchangeSeed-NA+]]
+
* [[RXN-15509]]
* [[PINA1th]]
+
* [[RXN-15510]]
* [[PINA1tm]]
+
* [[RXN-15511]]
* [[TRANS-RXN-101]]
+
* [[RXN-15512]]
* [[TransportSeed-NA+]]
+
* [[RXN-17276]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=na+}}
+
{{#set: common-name=2,3-diphospho-d-glycerate}}
{{#set: inchi-key=inchikey=fknqfgjonoiptf-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=xohueycvluuejj-uwtatzphsa-i}}
{{#set: molecular-weight=22.99}}
+
{{#set: molecular-weight=260.998}}

Revision as of 14:20, 26 August 2019

Metabolite 23-DIPHOSPHOGLYCERATE

  • common-name:
    • 2,3-diphospho-d-glycerate
  • smiles:
    • c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(=o)[o-]
  • inchi-key:
    • xohueycvluuejj-uwtatzphsa-i
  • molecular-weight:
    • 260.998

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality