Difference between revisions of "SJ16377"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8120 CPD-8120] == * common-name: ** di-homo-γ-linolenate * smiles: ** cccccc=ccc=ccc=...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Cerotoyl-ACPs Cerotoyl-ACPs] == * common-name: ** a cerotoyl-[acp] == Reaction(s) known to cons...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8120 CPD-8120] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Cerotoyl-ACPs Cerotoyl-ACPs] ==
 
* common-name:
 
* common-name:
** di-homo-γ-linolenate
+
** a cerotoyl-[acp]
* smiles:
 
** cccccc=ccc=ccc=cccccccc(=o)[o-]
 
* inchi-key:
 
** hobaelrkjckhqd-qnebeihssa-m
 
* molecular-weight:
 
** 305.479
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13435]]
+
* [[RXN-10062]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=di-homo-γ-linolenate}}
+
{{#set: common-name=a cerotoyl-[acp]}}
{{#set: inchi-key=inchikey=hobaelrkjckhqd-qnebeihssa-m}}
 
{{#set: molecular-weight=305.479}}
 

Revision as of 14:20, 26 August 2019

Metabolite Cerotoyl-ACPs

  • common-name:
    • a cerotoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a cerotoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.