Difference between revisions of "SJ07093"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Poly-Gamma-Glutamylcysteine-Glycines Poly-Gamma-Glutamylcysteine-Glycines] == * common-name: **...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15913 CPD-15913] == * common-name: ** aurachin c epoxide * smiles: ** cc(c)=cccc(c)=cccc(c)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15913 CPD-15913] == |
* common-name: | * common-name: | ||
| − | ** | + | ** aurachin c epoxide |
| + | * smiles: | ||
| + | ** cc(c)=cccc(c)=cccc(c)=ccc12(oc(c)1n(c3(c=cc=cc(c2=o)=3))o) | ||
| + | * inchi-key: | ||
| + | ** forhhprbeftlrm-yefhwucqsa-n | ||
| + | * molecular-weight: | ||
| + | ** 395.541 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-15029]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=aurachin c epoxide}} |
| + | {{#set: inchi-key=inchikey=forhhprbeftlrm-yefhwucqsa-n}} | ||
| + | {{#set: molecular-weight=395.541}} | ||
Revision as of 14:20, 26 August 2019
Contents
Metabolite CPD-15913
- common-name:
- aurachin c epoxide
- smiles:
- cc(c)=cccc(c)=cccc(c)=ccc12(oc(c)1n(c3(c=cc=cc(c2=o)=3))o)
- inchi-key:
- forhhprbeftlrm-yefhwucqsa-n
- molecular-weight:
- 395.541
