Difference between revisions of "SJ20743"

Revision as of 14:20, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LYS LYS] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PALMITATE PALMITATE] ==
 * common-name:
-** l-lysine
+** palmitate
 * smiles:
-** c([n+])cccc([n+])c([o-])=o
+** cccccccccccccccc([o-])=o
 * inchi-key:
-** kdxkernsbixsrk-yfkpbyrvsa-o
+** ipcsvzssvzvige-uhfffaoysa-m
 * molecular-weight:
-** 147.197
+** 255.42
 == Reaction(s) known to consume the compound ==
-* [[LYSINE--TRNA-LIGASE-RXN]]
+* [[FATTY-ACID-PEROXIDASE-RXN]]
-* [[LYSINE-N-ACETYLTRANSFERASE-RXN]]
+* [[RXN-9623]]
-* [[RXN-1961]]
-* [[biomass_rxn]]
 == Reaction(s) known to produce the compound ==
-* [[DIAMINOPIMDECARB-RXN]]
+* [[3.1.1.64-RXN]]
-* [[LYSINE-N-ACETYLTRANSFERASE-RXN]]
+* [[3.1.2.22-RXN]]
+* [[PALMITOYL-COA-HYDROLASE-RXN]]
+* [[RETINYL-PALMITATE-ESTERASE-RXN]]
+* [[RXN-12430]]
+* [[RXN-15065]]
+* [[RXN-16655]]
+* [[RXN-7952-CPD66-43/WATER//GLYCEROL/PALMITATE/PROTON.42.]]
+* [[RXN-9549]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=l-lysine}}
+{{#set: common-name=palmitate}}
-{{#set: inchi-key=inchikey=kdxkernsbixsrk-yfkpbyrvsa-o}}
+{{#set: inchi-key=inchikey=ipcsvzssvzvige-uhfffaoysa-m}}
-{{#set: molecular-weight=147.197}}
+{{#set: molecular-weight=255.42}}