Difference between revisions of "SJ20612"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13793 CPD-13793] == * common-name: ** 3-oxo-24-ethyl-cholest-5-ene * smiles: ** ccc(c(c)c)c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17894 CPD-17894] == * common-name: ** β-d-mannosyl-(c55 ω-saturated dolichyl pho...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13793 CPD-13793] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17894 CPD-17894] ==
 
* common-name:
 
* common-name:
** 3-oxo-24-ethyl-cholest-5-ene
+
** β-d-mannosyl-(c55 ω-saturated dolichyl phosphate)
 
* smiles:
 
* smiles:
** ccc(c(c)c)ccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(=o)ccc(c)1[ch]2ccc(c)34))))
+
** cc(c)cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(ccop(=o)([o-])oc1(oc(co)c(o)c(o)c(o)1))c
 
* inchi-key:
 
* inchi-key:
** kyofijxmvnqyfc-xjzkhkohsa-n
+
** mbyvktiiznuhkn-nivaaieqsa-m
 
* molecular-weight:
 
* molecular-weight:
** 412.698
+
** 1012.461
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12789]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12789]]
+
* [[RXN-16602]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-24-ethyl-cholest-5-ene}}
+
{{#set: common-name=β-d-mannosyl-(c55 ω-saturated dolichyl phosphate)}}
{{#set: inchi-key=inchikey=kyofijxmvnqyfc-xjzkhkohsa-n}}
+
{{#set: inchi-key=inchikey=mbyvktiiznuhkn-nivaaieqsa-m}}
{{#set: molecular-weight=412.698}}
+
{{#set: molecular-weight=1012.461}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-17894

  • common-name:
    • β-d-mannosyl-(c55 ω-saturated dolichyl phosphate)
  • smiles:
    • cc(c)cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(ccop(=o)([o-])oc1(oc(co)c(o)c(o)c(o)1))c
  • inchi-key:
    • mbyvktiiznuhkn-nivaaieqsa-m
  • molecular-weight:
    • 1012.461

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality