Difference between revisions of "SJ06150"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11665 CPD-11665] == * common-name: ** serotonin o-sulfate * smiles: ** c(n)cc1(=cnc2(=c1c=c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-196 CPD-196] == * common-name: ** octanoyl-coa * smiles: ** cccccccc(=o)sccnc(=o)ccnc(=o)c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11665 CPD-11665] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-196 CPD-196] ==
 
* common-name:
 
* common-name:
** serotonin o-sulfate
+
** octanoyl-coa
 
* smiles:
 
* smiles:
** c(n)cc1(=cnc2(=c1c=c(os(=o)(=o)o)c=c2))
+
** cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** jfwysggscoobgk-uhfffaoysa-n
+
** kqmzyoxobsxmii-cecatxlmsa-j
 
* molecular-weight:
 
* molecular-weight:
** 256.276
+
** 889.7
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[3.1.2.19-RXN-CPD-196/WATER//CPD-195/CO-A/PROTON.35.]]
 +
* [[ACACT4]]
 +
* [[ACACT4h]]
 +
* [[ACECOATRANS-RXN-CPD-196/ACET//CPD-195/ACETYL-COA.33.]]
 +
* [[ACOA80OR]]
 +
* [[RXN-12669]]
 +
* [[RXN-14229]]
 +
* [[THIOESTER-RXN[CCO-CYTOSOL]-CPD-196/WATER//CPD-195/CO-A/PROTON.48.]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10777]]
+
* [[ACACT4]]
 +
* [[R223-RXN]]
 +
* [[RXN-13617]]
 +
* [[RXN-14229]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=serotonin o-sulfate}}
+
{{#set: common-name=octanoyl-coa}}
{{#set: inchi-key=inchikey=jfwysggscoobgk-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=kqmzyoxobsxmii-cecatxlmsa-j}}
{{#set: molecular-weight=256.276}}
+
{{#set: molecular-weight=889.7}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-196

  • common-name:
    • octanoyl-coa
  • smiles:
    • cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • kqmzyoxobsxmii-cecatxlmsa-j
  • molecular-weight:
    • 889.7

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality