Difference between revisions of "SJ01895"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2121 CPD0-2121] == * common-name: ** trans-hex-2-enoyl-coa * smiles: ** cccc=cc(=o)sccnc(=...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-LACTOYL-GLUTATHIONE S-LACTOYL-GLUTATHIONE] == * common-name: ** (r)-s-lactoylglutathione * sm...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2121 CPD0-2121] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-LACTOYL-GLUTATHIONE S-LACTOYL-GLUTATHIONE] ==
 
* common-name:
 
* common-name:
** trans-hex-2-enoyl-coa
+
** (r)-s-lactoylglutathione
 
* smiles:
 
* smiles:
** cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc(o)c(=o)scc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
 
* inchi-key:
 
* inchi-key:
** oinxhibnzuuimr-ixuyqxaasa-j
+
** vdydcvuwiliyqf-csmhccousa-m
 
* molecular-weight:
 
* molecular-weight:
** 859.631
+
** 378.376
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ECOAH2h]]
+
* [[GLYOXI-RXN]]
* [[RXN-12559]]
+
* [[GLYOXII-RXN]]
* [[RXN-14278]]
 
* [[TRANSENOYLCOARED-RXN-HEXANOYL-COA/NADP//CPD0-2121/NADPH/PROTON.42.]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ECOAH2h]]
+
* [[GLYOXI-RXN]]
* [[RXN-12567]]
 
* [[RXN-14278]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=trans-hex-2-enoyl-coa}}
+
{{#set: common-name=(r)-s-lactoylglutathione}}
{{#set: inchi-key=inchikey=oinxhibnzuuimr-ixuyqxaasa-j}}
+
{{#set: inchi-key=inchikey=vdydcvuwiliyqf-csmhccousa-m}}
{{#set: molecular-weight=859.631}}
+
{{#set: molecular-weight=378.376}}

Revision as of 14:20, 26 August 2019

Metabolite S-LACTOYL-GLUTATHIONE

  • common-name:
    • (r)-s-lactoylglutathione
  • smiles:
    • cc(o)c(=o)scc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
  • inchi-key:
    • vdydcvuwiliyqf-csmhccousa-m
  • molecular-weight:
    • 378.376

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality