Difference between revisions of "SJ06882"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8088 CPD-8088] == * common-name: ** 1-linoleoyl-2-oleoyl-phosphatidylcholine * smiles: ** c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-596 CPD-596] == * common-name: ** n6,n6-dimethyl-l-arginine * smiles: ** cn(c(=[n+])ncccc([...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8088 CPD-8088] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-596 CPD-596] ==
 
* common-name:
 
* common-name:
** 1-linoleoyl-2-oleoyl-phosphatidylcholine
+
** n6,n6-dimethyl-l-arginine
 
* smiles:
 
* smiles:
** cccccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
+
** cn(c(=[n+])ncccc([n+])c(=o)[o-])c
 
* inchi-key:
 
* inchi-key:
** rtazwrzkfstmoy-nmsvecgzsa-n
+
** ydgmgexadbmomj-lurjtmiesa-o
 
* molecular-weight:
 
* molecular-weight:
** 784.107
+
** 203.264
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8321]]
+
* [[DIMETHYLARGININASE-RXN]]
* [[RXN-8328]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8320]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-linoleoyl-2-oleoyl-phosphatidylcholine}}
+
{{#set: common-name=n6,n6-dimethyl-l-arginine}}
{{#set: inchi-key=inchikey=rtazwrzkfstmoy-nmsvecgzsa-n}}
+
{{#set: inchi-key=inchikey=ydgmgexadbmomj-lurjtmiesa-o}}
{{#set: molecular-weight=784.107}}
+
{{#set: molecular-weight=203.264}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-596

  • common-name:
    • n6,n6-dimethyl-l-arginine
  • smiles:
    • cn(c(=[n+])ncccc([n+])c(=o)[o-])c
  • inchi-key:
    • ydgmgexadbmomj-lurjtmiesa-o
  • molecular-weight:
    • 203.264

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality