Difference between revisions of "SJ14156"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8079 CPD-8079] == * common-name: ** 1-18:1-2-16:3-monogalactosyldiacylglycerol * smiles: **...")
 
(Created page with "Category:gene == Gene SJ04912 == * transcription-direction: ** negative * right-end-position: ** 71999 * left-end-position: ** 60967 * centisome-position: ** 62.10919...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8079 CPD-8079] ==
+
== Gene SJ04912 ==
−
* common-name:
+
* transcription-direction:
−
** 1-18:1-2-16:3-monogalactosyldiacylglycerol
+
** negative
−
* smiles:
+
* right-end-position:
−
** ccccccccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=ccc=ccc)=o)=o
+
** 71999
−
* inchi-key:
+
* left-end-position:
−
** uledcqdcqahgfd-lukloydesa-n
+
** 60967
−
* molecular-weight:
+
* centisome-position:
−
** 751.052
+
** 62.10919   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
== Reaction(s) known to produce the compound ==
+
* [[S.japonica_carotenoid_curated]]
−
* [[RXN-8303]]
+
== Reaction(s) associated ==
−
== Reaction(s) of unknown directionality ==
+
* [[3.1.3.16-RXN]]
−
{{#set: common-name=1-18:1-2-16:3-monogalactosyldiacylglycerol}}
+
** Category: [[annotation]]
−
{{#set: inchi-key=inchikey=uledcqdcqahgfd-lukloydesa-n}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: molecular-weight=751.052}}
+
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[PROTEIN-KINASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=71999}}
 +
{{#set: left-end-position=60967}}
 +
{{#set: centisome-position=62.10919    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=3}}

Revision as of 14:20, 26 August 2019

Gene SJ04912

  • transcription-direction:
    • negative
  • right-end-position:
    • 71999
  • left-end-position:
    • 60967
  • centisome-position:
    • 62.10919

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ14156&oldid=16243"