Difference between revisions of "PWY-5873"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NICOTINATE_NUCLEOTIDE NICOTINATE_NUCLEOTIDE] == * common-name: ** β-nicotinate d-ribonucle...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-Ribofuranose D-Ribofuranose] == * common-name: ** d-ribofuranose == Reaction(s) known to cons...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NICOTINATE_NUCLEOTIDE NICOTINATE_NUCLEOTIDE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-Ribofuranose D-Ribofuranose] ==
 
* common-name:
 
* common-name:
** β-nicotinate d-ribonucleotide
+
** d-ribofuranose
* smiles:
 
** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)[o-])c=2))
 
* inchi-key:
 
** jouiqrnqjgxqdc-zyuzmqfosa-l
 
* molecular-weight:
 
** 333.191
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[NICONUCADENYLYLTRAN-RXN]]
+
* [[RXN-4315]]
* [[RXN-14227]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[NICOTINATEPRIBOSYLTRANS-RXN]]
+
* [[PURINE-NUCLEOSIDASE-RXN]]
* [[QUINOPRIBOTRANS-RXN]]
+
* [[RIBOSYLPYRIMIDINE-NUCLEOSIDASE-RXN]]
* [[RXN-8443]]
+
* [[RXN-4315]]
 +
* [[RXN0-361]]
 +
* [[RXN0-363]]
 +
* [[RXN0-366]]
 +
* [[URIDINE-NUCLEOSIDASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-nicotinate d-ribonucleotide}}
+
{{#set: common-name=d-ribofuranose}}
{{#set: inchi-key=inchikey=jouiqrnqjgxqdc-zyuzmqfosa-l}}
 
{{#set: molecular-weight=333.191}}
 

Revision as of 09:22, 27 August 2019