Difference between revisions of "PWY-5344"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THR-tRNAs THR-tRNAs] == * common-name: ** a trnathr == Reaction(s) known to consume the compoun...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UBIQUINONE-8 UBIQUINONE-8] == * common-name: ** ubiquinone-8 * smiles: ** cc(c)=cccc(c)=cccc(c)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THR-tRNAs THR-tRNAs] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UBIQUINONE-8 UBIQUINONE-8] ==
 
* common-name:
 
* common-name:
** a trnathr
+
** ubiquinone-8
 +
* smiles:
 +
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c(oc)=c(oc)c(=o)c(c)=1)=o)
 +
* inchi-key:
 +
** icfizjqgjajrsu-sghxuwjisa-n
 +
* molecular-weight:
 +
** 727.121
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[THREONINE--TRNA-LIGASE-RXN]]
+
* [[R00281]]
 +
* [[SUCDH_LPAREN_q8_RPAREN_m]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[R00281]]
 +
* [[SUCDH_LPAREN_q8_RPAREN_m]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a trnathr}}
+
{{#set: common-name=ubiquinone-8}}
 +
{{#set: inchi-key=inchikey=icfizjqgjajrsu-sghxuwjisa-n}}
 +
{{#set: molecular-weight=727.121}}

Revision as of 09:22, 27 August 2019

Metabolite UBIQUINONE-8

  • common-name:
    • ubiquinone-8
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c(oc)=c(oc)c(=o)c(c)=1)=o)
  • inchi-key:
    • icfizjqgjajrsu-sghxuwjisa-n
  • molecular-weight:
    • 727.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality