Difference between revisions of "PWY-5048"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-NITROSOGLUTATHIONE S-NITROSOGLUTATHIONE] == * common-name: ** s-nitrosoglutathione * smiles:...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-GLYCERO-PHOSPHORYLCHOLINE L-1-GLYCERO-PHOSPHORYLCHOLINE] == * common-name: ** sn-glycero-3-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-NITROSOGLUTATHIONE S-NITROSOGLUTATHIONE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-GLYCERO-PHOSPHORYLCHOLINE L-1-GLYCERO-PHOSPHORYLCHOLINE] ==
 
* common-name:
 
* common-name:
** s-nitrosoglutathione
+
** sn-glycero-3-phosphocholine
 
* smiles:
 
* smiles:
** c(sn=o)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
+
** c([n+](c)(c)c)cop([o-])(=o)occ(o)co
 
* inchi-key:
 
* inchi-key:
** hyhsbsxuhzoylx-wdskdsinsa-m
+
** suhoquvvvlnyqr-mrvpvssysa-n
 
* molecular-weight:
 
* molecular-weight:
** 335.311
+
** 257.223
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17884]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[LYSOPHOSPHOLIPASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=s-nitrosoglutathione}}
+
{{#set: common-name=sn-glycero-3-phosphocholine}}
{{#set: inchi-key=inchikey=hyhsbsxuhzoylx-wdskdsinsa-m}}
+
{{#set: inchi-key=inchikey=suhoquvvvlnyqr-mrvpvssysa-n}}
{{#set: molecular-weight=335.311}}
+
{{#set: molecular-weight=257.223}}

Revision as of 09:22, 27 August 2019

Metabolite L-1-GLYCERO-PHOSPHORYLCHOLINE

  • common-name:
    • sn-glycero-3-phosphocholine
  • smiles:
    • c([n+](c)(c)c)cop([o-])(=o)occ(o)co
  • inchi-key:
    • suhoquvvvlnyqr-mrvpvssysa-n
  • molecular-weight:
    • 257.223

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality