Difference between revisions of "PWY-5667"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-oxo-stearoyl-ACPs 3-oxo-stearoyl-ACPs] == * common-name: ** a 3-oxo-stearoyl-[acp] == Reactio...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-27 CPD66-27] == * common-name: ** pregn-5-ene-3,20-dione-17-ol * smiles: ** cc(=o)c4(o)(c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-oxo-stearoyl-ACPs 3-oxo-stearoyl-ACPs] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-27 CPD66-27] ==
 
* common-name:
 
* common-name:
** a 3-oxo-stearoyl-[acp]
+
** pregn-5-ene-3,20-dione-17-ol
 +
* smiles:
 +
** cc(=o)c4(o)(ccc2(c(c)(ccc1(c3(c)(c(=ccc12)cc(=o)cc3)))4))
 +
* inchi-key:
 +
** rcfjdvcranozel-uhfffaoysa-n
 +
* molecular-weight:
 +
** 330.466
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9633]]
+
* [[RXN66-350]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9632]]
+
* [[RXN66-350]]
* [[RXN3O-1803]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 3-oxo-stearoyl-[acp]}}
+
{{#set: common-name=pregn-5-ene-3,20-dione-17-ol}}
 +
{{#set: inchi-key=inchikey=rcfjdvcranozel-uhfffaoysa-n}}
 +
{{#set: molecular-weight=330.466}}

Revision as of 09:22, 27 August 2019

Metabolite CPD66-27

  • common-name:
    • pregn-5-ene-3,20-dione-17-ol
  • smiles:
    • cc(=o)c4(o)(ccc2(c(c)(ccc1(c3(c)(c(=ccc12)cc(=o)cc3)))4))
  • inchi-key:
    • rcfjdvcranozel-uhfffaoysa-n
  • molecular-weight:
    • 330.466

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality