Difference between revisions of "GALLATE-DEGRADATION-I-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CYSTEATE L-CYSTEATE] == * common-name: ** l-cysteate * smiles: ** c(c([n+])c(=o)[o-])s(=o)(=o...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23S-rRNA-2-methyladenine2503 23S-rRNA-2-methyladenine2503] == * common-name: ** a 2-methyladeni...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CYSTEATE L-CYSTEATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23S-rRNA-2-methyladenine2503 23S-rRNA-2-methyladenine2503] ==
 
* common-name:
 
* common-name:
** l-cysteate
+
** a 2-methyladenine2503 in 23s rrna
* smiles:
 
** c(c([n+])c(=o)[o-])s(=o)(=o)[o-]
 
* inchi-key:
 
** xvoyscvbglvsol-reohclbhsa-m
 
* molecular-weight:
 
** 168.144
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11737]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11737]]
+
* [[RXN-11586]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-cysteate}}
+
{{#set: common-name=a 2-methyladenine2503 in 23s rrna}}
{{#set: inchi-key=inchikey=xvoyscvbglvsol-reohclbhsa-m}}
 
{{#set: molecular-weight=168.144}}
 

Revision as of 09:22, 27 August 2019

Metabolite 23S-rRNA-2-methyladenine2503

  • common-name:
    • a 2-methyladenine2503 in 23s rrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality