Difference between revisions of "PWY-2541"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11876 CPD-11876] == * common-name: ** 3-methoxy-4-hydroxyphenylglycolaldehyde * smiles: **...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HG+2 HG+2] == * common-name: ** hg2+ * smiles: ** [hg++] * inchi-key: ** bqpiggfysbelgy-uhfffao...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11876 CPD-11876] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HG+2 HG+2] ==
 
* common-name:
 
* common-name:
** 3-methoxy-4-hydroxyphenylglycolaldehyde
+
** hg2+
 
* smiles:
 
* smiles:
** coc1(=c(o)c=cc(c(o)c=o)=c1)
+
** [hg++]
 
* inchi-key:
 
* inchi-key:
** visajvapypfkcl-qmmmgpobsa-n
+
** bqpiggfysbelgy-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 182.176
+
** 200.59
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10915]]
+
* [[MERCURY-II-REDUCTASE-RXN]]
* [[RXN-10917]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10910]]
 
* [[RXN-10913]]
 
* [[RXN-10915]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-methoxy-4-hydroxyphenylglycolaldehyde}}
+
{{#set: common-name=hg2+}}
{{#set: inchi-key=inchikey=visajvapypfkcl-qmmmgpobsa-n}}
+
{{#set: inchi-key=inchikey=bqpiggfysbelgy-uhfffaoysa-n}}
{{#set: molecular-weight=182.176}}
+
{{#set: molecular-weight=200.59}}

Revision as of 09:22, 27 August 2019

Metabolite HG+2

  • common-name:
    • hg2+
  • smiles:
    • [hg++]
  • inchi-key:
    • bqpiggfysbelgy-uhfffaoysa-n
  • molecular-weight:
    • 200.59

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality