Difference between revisions of "PWY-6164"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15360 CPD-15360] == * smiles: ** cc(c)=ccnc3(c2(n=cn(c1(oc(cop(=o)([o-])o[a trna])c(op([o-]...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1086 CPD-1086] == * common-name: ** 5-amino-6-(5-phospho-d-ribitylamino)uracil * smiles: **...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1086 CPD-1086] == |
| + | * common-name: | ||
| + | ** 5-amino-6-(5-phospho-d-ribitylamino)uracil | ||
* smiles: | * smiles: | ||
| − | ** | + | ** c(nc1(nc(nc(=o)c(n)=1)=o))c(o)c(o)c(o)cop([o-])(=o)[o-] |
| − | * | + | * inchi-key: |
| − | ** | + | ** rqrinyisxyazkl-rpdrrwsusa-l |
| + | * molecular-weight: | ||
| + | ** 354.213 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[RIBOFLAVINSYNREDUC-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5-amino-6-(5-phospho-d-ribitylamino)uracil}} |
| + | {{#set: inchi-key=inchikey=rqrinyisxyazkl-rpdrrwsusa-l}} | ||
| + | {{#set: molecular-weight=354.213}} | ||
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-1086
- common-name:
- 5-amino-6-(5-phospho-d-ribitylamino)uracil
- smiles:
- c(nc1(nc(nc(=o)c(n)=1)=o))c(o)c(o)c(o)cop([o-])(=o)[o-]
- inchi-key:
- rqrinyisxyazkl-rpdrrwsusa-l
- molecular-weight:
- 354.213
