Difference between revisions of "PWY-5491"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4581 CPD-4581] == * common-name: ** zymosterone * smiles: ** cc(c)=cccc(c)[ch]3(cc[ch]4(c2(...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-COUMAROYL-COA P-COUMAROYL-COA] == * common-name: ** 4-coumaroyl-coa * smiles: ** cc(c)(c(o)c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4581 CPD-4581] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-COUMAROYL-COA P-COUMAROYL-COA] ==
 
* common-name:
 
* common-name:
** zymosterone
+
** 4-coumaroyl-coa
 
* smiles:
 
* smiles:
** cc(c)=cccc(c)[ch]3(cc[ch]4(c2(cc[ch]1(cc(=o)ccc(c)1c=2ccc(c)34))))
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=cc(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** aunlirxijavbnm-zsbatxslsa-n
+
** dmzokbalnzwdki-matmfaihsa-j
 
* molecular-weight:
 
* molecular-weight:
** 382.628
+
** 909.648
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-319]]
+
* [[NARINGENIN-CHALCONE-SYNTHASE-RXN]]
 +
* [[RXN-1101]]
 +
* [[RXN-11244]]
 +
* [[RXN-3142]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-318]]
+
* [[4-COUMARATE--COA-LIGASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=zymosterone}}
+
{{#set: common-name=4-coumaroyl-coa}}
{{#set: inchi-key=inchikey=aunlirxijavbnm-zsbatxslsa-n}}
+
{{#set: inchi-key=inchikey=dmzokbalnzwdki-matmfaihsa-j}}
{{#set: molecular-weight=382.628}}
+
{{#set: molecular-weight=909.648}}

Revision as of 09:22, 27 August 2019

Metabolite P-COUMAROYL-COA

  • common-name:
    • 4-coumaroyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=cc(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
  • inchi-key:
    • dmzokbalnzwdki-matmfaihsa-j
  • molecular-weight:
    • 909.648

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality