Difference between revisions of "PWY-5945"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11938 CPD-11938] == * common-name: ** 1d-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakis...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARBAMYUL-L-ASPARTATE CARBAMYUL-L-ASPARTATE] == * common-name: ** n-carbamoyl-l-aspartate * smi...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11938 CPD-11938] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARBAMYUL-L-ASPARTATE CARBAMYUL-L-ASPARTATE] ==
 
* common-name:
 
* common-name:
** 1d-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate
+
** n-carbamoyl-l-aspartate
 
* smiles:
 
* smiles:
** c1(op(=o)([o-])[o-])(c(op(=o)([o-])[o-])c(op([o-])(=o)op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(op([o-])(=o)[o-])([o-])=o)c(op([o-])([o-])=o)1)
+
** c(=o)([o-])cc(nc(n)=o)c([o-])=o
 
* inchi-key:
 
* inchi-key:
** hhqooerqsfjgep-slwywoedsa-a
+
** hlkxyzvtanabhz-reohclbhsa-l
 
* molecular-weight:
 
* molecular-weight:
** 805.885
+
** 174.113
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10965]]
+
* [[ASPCARBTRANS-RXN]]
* [[RXN-10975]]
+
* [[DIHYDROOROT-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.4.24-RXN]]
+
* [[ASPCARBTRANS-RXN]]
* [[RXN-10965]]
+
* [[DIHYDROOROT-RXN]]
* [[RXN-10974]]
 
* [[RXN-10975]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1d-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate}}
+
{{#set: common-name=n-carbamoyl-l-aspartate}}
{{#set: inchi-key=inchikey=hhqooerqsfjgep-slwywoedsa-a}}
+
{{#set: inchi-key=inchikey=hlkxyzvtanabhz-reohclbhsa-l}}
{{#set: molecular-weight=805.885}}
+
{{#set: molecular-weight=174.113}}

Revision as of 09:22, 27 August 2019

Metabolite CARBAMYUL-L-ASPARTATE

  • common-name:
    • n-carbamoyl-l-aspartate
  • smiles:
    • c(=o)([o-])cc(nc(n)=o)c([o-])=o
  • inchi-key:
    • hlkxyzvtanabhz-reohclbhsa-l
  • molecular-weight:
    • 174.113

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality