Difference between revisions of "HOMOSER-METSYN-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4822 CPD-4822] == * common-name: ** kanamycin b * smiles: ** c([n+])c1(c(o)c(o)c([n+])c(o1)...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13205 CPD-13205] == * common-name: ** cellotetraose * smiles: ** c(c(c(c(c(co)o)oc1(c(c(c(c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4822 CPD-4822] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13205 CPD-13205] ==
 
* common-name:
 
* common-name:
** kanamycin b
+
** cellotetraose
 
* smiles:
 
* smiles:
** c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(co)c(o)c([n+])c(o)3))[n+]))
+
** c(c(c(c(c(co)o)oc1(c(c(c(c(co)o1)oc2(c(c(c(c(co)o2)oc3(c(c(c(c(co)o3)o)o)o))o)o))o)o))o)o)=o
 
* inchi-key:
 
* inchi-key:
** skklouvuunmcje-fqsmhnglsa-s
+
** uyqjcpnsavwafu-zeuiethysa-n
 
* molecular-weight:
 
* molecular-weight:
** 488.557
+
** 666.583
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14553]]
+
* [[RXN-12305]]
* [[RXN-15287]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=kanamycin b}}
+
{{#set: common-name=cellotetraose}}
{{#set: inchi-key=inchikey=skklouvuunmcje-fqsmhnglsa-s}}
+
{{#set: inchi-key=inchikey=uyqjcpnsavwafu-zeuiethysa-n}}
{{#set: molecular-weight=488.557}}
+
{{#set: molecular-weight=666.583}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-13205

  • common-name:
    • cellotetraose
  • smiles:
    • c(c(c(c(c(co)o)oc1(c(c(c(c(co)o1)oc2(c(c(c(c(co)o2)oc3(c(c(c(c(co)o3)o)o)o))o)o))o)o))o)o)=o
  • inchi-key:
    • uyqjcpnsavwafu-zeuiethysa-n
  • molecular-weight:
    • 666.583

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality