Difference between revisions of "PWY-7559"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PREPHENATE PREPHENATE] == * common-name: ** prephenate * smiles: ** c(=o)([o-])c(=o)cc1(c(=o)[o...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BILIVERDINE BILIVERDINE] == * common-name: ** biliverdin-ix-α * smiles: ** c=cc1(c(nc(c(c...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BILIVERDINE BILIVERDINE] == |
* common-name: | * common-name: | ||
− | ** | + | ** biliverdin-ix-α |
* smiles: | * smiles: | ||
− | ** c(=o)( | + | ** c=cc1(c(nc(c(c)=1)=o)=cc4(=c(c)c(=c(c=c3(n=c(c=c2(c(c)=c(c=c)c(n2)=o))c(c)=c3ccc([o-])=o))n4)ccc([o-])=o)) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** qbuvfdktzjnupp-msgwkzgbsa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 580.639 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[1.3.7.2-RXN]] |
− | * [[ | + | * [[1.3.7.4-RXN]] |
− | + | * [[R05818]] | |
− | * [[ | ||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[HEME-OXYGENASE-DECYCLIZING-RXN]] |
− | + | * [[R05818]] | |
− | * [[ | + | * [[RXN-17523]] |
− | * [[ | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=biliverdin-ix-α}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qbuvfdktzjnupp-msgwkzgbsa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=580.639}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite BILIVERDINE
- common-name:
- biliverdin-ix-α
- smiles:
- c=cc1(c(nc(c(c)=1)=o)=cc4(=c(c)c(=c(c=c3(n=c(c=c2(c(c)=c(c=c)c(n2)=o))c(c)=c3ccc([o-])=o))n4)ccc([o-])=o))
- inchi-key:
- qbuvfdktzjnupp-msgwkzgbsa-l
- molecular-weight:
- 580.639