Difference between revisions of "PWY-5818"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BILIVERDINE BILIVERDINE] == * common-name: ** biliverdin-ix-α * smiles: ** c=cc1(c(nc(c(c...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Purine-Deoxyribonucleosides Purine-Deoxyribonucleosides] == * common-name: ** a purine 2'-deoxy...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BILIVERDINE BILIVERDINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Purine-Deoxyribonucleosides Purine-Deoxyribonucleosides] ==
 
* common-name:
 
* common-name:
** biliverdin-ix-α
+
** a purine 2'-deoxyribonucleoside
* smiles:
 
** c=cc1(c(nc(c(c)=1)=o)=cc4(=c(c)c(=c(c=c3(n=c(c=c2(c(c)=c(c=c)c(n2)=o))c(c)=c3ccc([o-])=o))n4)ccc([o-])=o))
 
* inchi-key:
 
** qbuvfdktzjnupp-msgwkzgbsa-l
 
* molecular-weight:
 
** 580.639
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.3.7.2-RXN]]
+
* [[RXN-14029]]
* [[1.3.7.4-RXN]]
 
* [[R05818]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HEME-OXYGENASE-DECYCLIZING-RXN]]
+
* [[RXN-14029]]
* [[R05818]]
 
* [[RXN-17523]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=biliverdin-ix-α}}
+
{{#set: common-name=a purine 2'-deoxyribonucleoside}}
{{#set: inchi-key=inchikey=qbuvfdktzjnupp-msgwkzgbsa-l}}
 
{{#set: molecular-weight=580.639}}
 

Revision as of 09:22, 27 August 2019

Metabolite Purine-Deoxyribonucleosides

  • common-name:
    • a purine 2'-deoxyribonucleoside

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality