Difference between revisions of "P641-PWY"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7061 CPD-7061] == * common-name: ** pheophorbide a * smiles: ** c=cc5(=c(c)c6(=cc1(c(c)c(cc...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14159 CPD-14159] == * common-name: ** 6''-o-carbamoylkanamycin b * smiles: ** c([n+])c1(c(o...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14159 CPD-14159] == |
* common-name: | * common-name: | ||
− | ** | + | ** 6''-o-carbamoylkanamycin b |
* smiles: | * smiles: | ||
− | ** c | + | ** c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)c(o)c([n+])c(o)3))[n+])) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** xcstznjiqfivpe-fqsmhnglsa-s |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 531.582 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-14553]] | ||
+ | * [[RXN-15287]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=6''-o-carbamoylkanamycin b}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xcstznjiqfivpe-fqsmhnglsa-s}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=531.582}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-14159
- common-name:
- 6-o-carbamoylkanamycin b
- smiles:
- c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)c(o)c([n+])c(o)3))[n+]))
- inchi-key:
- xcstznjiqfivpe-fqsmhnglsa-s
- molecular-weight:
- 531.582