Difference between revisions of "PWY-5892"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15566 CPD-15566] == * common-name: ** (2e,4e)-tetradecadienoyl-coa * smiles: ** cccccccccc=...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-Gal-NAc--Glycoproteins D-Gal-NAc--Glycoproteins] == * common-name: ** an n-acetyl-α-d-g...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15566 CPD-15566] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-Gal-NAc--Glycoproteins D-Gal-NAc--Glycoproteins] ==
 
* common-name:
 
* common-name:
** (2e,4e)-tetradecadienoyl-coa
+
** an n-acetyl-α-d-galactosalaminyl-[glycoprotein]
* smiles:
 
** cccccccccc=cc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
** ulogshzmdlrqry-inbgbncrsa-j
 
* molecular-weight:
 
** 969.83
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14715]]
+
* [[2.4.1.122-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e,4e)-tetradecadienoyl-coa}}
+
{{#set: common-name=an n-acetyl-α-d-galactosalaminyl-[glycoprotein]}}
{{#set: inchi-key=inchikey=ulogshzmdlrqry-inbgbncrsa-j}}
 
{{#set: molecular-weight=969.83}}
 

Revision as of 09:22, 27 August 2019

Metabolite D-Gal-NAc--Glycoproteins

  • common-name:
    • an n-acetyl-α-d-galactosalaminyl-[glycoprotein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an n-acetyl-α-d-galactosalaminyl-[glycoprotein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.