Difference between revisions of "PWY-7870"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GAMMA-GLUTAMYLCYSTEINE L-GAMMA-GLUTAMYLCYSTEINE] == * common-name: ** γ-l-glutamyl-l-cy...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15015 CPD-15015] == * common-name: ** 4-hydroxy-2-oxoglutarate == Reaction(s) known to cons...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GAMMA-GLUTAMYLCYSTEINE L-GAMMA-GLUTAMYLCYSTEINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15015 CPD-15015] ==
 
* common-name:
 
* common-name:
** γ-l-glutamyl-l-cysteine
+
** 4-hydroxy-2-oxoglutarate
* smiles:
 
** c(s)c(c([o-])=o)nc(=o)ccc([n+])c([o-])=o
 
* inchi-key:
 
** ritkhvbhsgluln-whfbiakzsa-m
 
* molecular-weight:
 
** 249.261
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GLUTATHIONE-SYN-RXN]]
+
* [[4OH2OXOGLUTARALDOL-RXN]]
* [[RXN-14430]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GLUTCYSLIG-RXN]]
+
* [[4OH2OXOGLUTARALDOL-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=γ-l-glutamyl-l-cysteine}}
+
{{#set: common-name=4-hydroxy-2-oxoglutarate}}
{{#set: inchi-key=inchikey=ritkhvbhsgluln-whfbiakzsa-m}}
 
{{#set: molecular-weight=249.261}}
 

Revision as of 09:22, 27 August 2019

Metabolite CPD-15015

  • common-name:
    • 4-hydroxy-2-oxoglutarate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality