Difference between revisions of "PWY66-161"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DITHIOTHREITOL DITHIOTHREITOL] == * common-name: ** l-dithiothreitol * smiles: ** c(s)c(o)c(o)c...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17348 CPD-17348] == * common-name: ** (2e, 11z,14z)-icosa-2,11,14-trienoyl-coa * smiles: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DITHIOTHREITOL DITHIOTHREITOL] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17348 CPD-17348] ==
 
* common-name:
 
* common-name:
** l-dithiothreitol
+
** (2e, 11z,14z)-icosa-2,11,14-trienoyl-coa
 
* smiles:
 
* smiles:
** c(s)c(o)c(o)cs
+
** cccccc=ccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** vhjlvaabsrfdpm-imjsidkusa-n
+
** jlhullpftgligf-dbyuabgnsa-j
 
* molecular-weight:
 
* molecular-weight:
** 154.242
+
** 1051.975
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.1.4.1-RXN]]
+
* [[RXN-16097]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.1.4.1-RXN]]
+
* [[RXN-16096]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-dithiothreitol}}
+
{{#set: common-name=(2e, 11z,14z)-icosa-2,11,14-trienoyl-coa}}
{{#set: inchi-key=inchikey=vhjlvaabsrfdpm-imjsidkusa-n}}
+
{{#set: inchi-key=inchikey=jlhullpftgligf-dbyuabgnsa-j}}
{{#set: molecular-weight=154.242}}
+
{{#set: molecular-weight=1051.975}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-17348

  • common-name:
    • (2e, 11z,14z)-icosa-2,11,14-trienoyl-coa
  • smiles:
    • cccccc=ccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • jlhullpftgligf-dbyuabgnsa-j
  • molecular-weight:
    • 1051.975

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality