Difference between revisions of "P164-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYSTINE CYSTINE] == * common-name: ** l-cystine * smiles: ** c(c(c(=o)[o-])[n+])sscc(c([o-])=o)...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-uridine34 tRNA-uridine34] == * common-name: ** a uridine34 in trna == Reaction(s) known to...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYSTINE CYSTINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-uridine34 tRNA-uridine34] ==
 
* common-name:
 
* common-name:
** l-cystine
+
** a uridine34 in trna
* smiles:
 
** c(c(c(=o)[o-])[n+])sscc(c([o-])=o)[n+]
 
* inchi-key:
 
** levwyrkdkasidu-imjsidkusa-n
 
* molecular-weight:
 
** 240.292
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[CYSTHIOCYS-RXN]]
+
* [[RXN-16820]]
* [[RXN-15128]]
+
* [[RXN0-2023]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-cystine}}
+
{{#set: common-name=a uridine34 in trna}}
{{#set: inchi-key=inchikey=levwyrkdkasidu-imjsidkusa-n}}
 
{{#set: molecular-weight=240.292}}
 

Revision as of 09:22, 27 August 2019

Metabolite tRNA-uridine34

  • common-name:
    • a uridine34 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality