Difference between revisions of "HISDEG-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-24-DINITROPHENYLGLUTATHIONE S-24-DINITROPHENYLGLUTATHIONE] == * common-name: ** 2,4-dinitroph...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Alpha-hydroxydihydroceramides Alpha-hydroxydihydroceramides] == * common-name: ** a (2'r)-2'-hy...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-24-DINITROPHENYLGLUTATHIONE S-24-DINITROPHENYLGLUTATHIONE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Alpha-hydroxydihydroceramides Alpha-hydroxydihydroceramides] ==
 
* common-name:
 
* common-name:
** 2,4-dinitrophenyl-s-glutathione
+
** a (2'r)-2'-hydroxydihydroceramide
* smiles:
 
** c(=o)([o-])cnc(=o)c(nc(=o)ccc([n+])c(=o)[o-])csc1(c=cc([n+]([o-])=o)=cc([n+]([o-])=o)=1)
 
* inchi-key:
 
** fxeukvkgtkddiq-uwvggrqhsa-m
 
* molecular-weight:
 
** 472.406
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GST-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GST-RXN]]
+
* [[RXN-7796]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2,4-dinitrophenyl-s-glutathione}}
+
{{#set: common-name=a (2'r)-2'-hydroxydihydroceramide}}
{{#set: inchi-key=inchikey=fxeukvkgtkddiq-uwvggrqhsa-m}}
 
{{#set: molecular-weight=472.406}}
 

Revision as of 09:22, 27 August 2019

Metabolite Alpha-hydroxydihydroceramides

  • common-name:
    • a (2'r)-2'-hydroxydihydroceramide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality