Difference between revisions of "PWY-7344"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CELLOBIOSE CELLOBIOSE] == * common-name: ** β-d-cellobiose * smiles: ** c(c2(c(c(c(c(oc1(c...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-N-ACETYLMURAMATE UDP-N-ACETYLMURAMATE] == * common-name: ** udp-n-acetyl-α-d-muramate...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CELLOBIOSE CELLOBIOSE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-N-ACETYLMURAMATE UDP-N-ACETYLMURAMATE] ==
 
* common-name:
 
* common-name:
** β-d-cellobiose
+
** udp-n-acetyl-α-d-muramate
 
* smiles:
 
* smiles:
** c(c2(c(c(c(c(oc1(c(oc(c(c1o)o)o)co))o2)o)o)o))o
+
** cc(c([o-])=o)oc3(c(o)c(co)oc(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))c(nc(c)=o)3)
 
* inchi-key:
 
* inchi-key:
** gubgytabksrvrq-qrzgkkjrsa-n
+
** nqbrvzndbbmblj-mqtlhlsbsa-k
 
* molecular-weight:
 
* molecular-weight:
** 342.299
+
** 676.397
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10773]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.2.1.91-RXN]]
+
* [[UDPNACETYLMURAMATEDEHYDROG-RXN]]
* [[RXN-12305]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-d-cellobiose}}
+
{{#set: common-name=udp-n-acetyl-α-d-muramate}}
{{#set: inchi-key=inchikey=gubgytabksrvrq-qrzgkkjrsa-n}}
+
{{#set: inchi-key=inchikey=nqbrvzndbbmblj-mqtlhlsbsa-k}}
{{#set: molecular-weight=342.299}}
+
{{#set: molecular-weight=676.397}}

Revision as of 09:22, 27 August 2019

Metabolite UDP-N-ACETYLMURAMATE

  • common-name:
    • udp-n-acetyl-α-d-muramate
  • smiles:
    • cc(c([o-])=o)oc3(c(o)c(co)oc(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))c(nc(c)=o)3)
  • inchi-key:
    • nqbrvzndbbmblj-mqtlhlsbsa-k
  • molecular-weight:
    • 676.397

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality