Difference between revisions of "PWY-842"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Phenyl-Acetates Phenyl-Acetates] == * common-name: ** a phenyl acetate == Reaction(s) known to...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7063 CPD-7063] == * common-name: ** red chlorophyll catabolite * smiles: ** ccc1(c(c)=c(nc=...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7063 CPD-7063] == |
* common-name: | * common-name: | ||
− | ** | + | ** red chlorophyll catabolite |
+ | * smiles: | ||
+ | ** ccc1(c(c)=c(nc=1c=c4(c(c)=c5(c(=o)[c-](c(oc)=o)c(c2(c(ccc(=o)[o-])c(c)c(n=2)=cc3(c(c)=c(c=c)c(=o)n3)))=c(n4)5)))c=o) | ||
+ | * inchi-key: | ||
+ | ** gvtpycxgtfqzdt-yssugppcsa-m | ||
+ | * molecular-weight: | ||
+ | ** 624.692 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-7741]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-7740]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=red chlorophyll catabolite}} |
+ | {{#set: inchi-key=inchikey=gvtpycxgtfqzdt-yssugppcsa-m}} | ||
+ | {{#set: molecular-weight=624.692}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-7063
- common-name:
- red chlorophyll catabolite
- smiles:
- ccc1(c(c)=c(nc=1c=c4(c(c)=c5(c(=o)[c-](c(oc)=o)c(c2(c(ccc(=o)[o-])c(c)c(n=2)=cc3(c(c)=c(c=c)c(=o)n3)))=c(n4)5)))c=o)
- inchi-key:
- gvtpycxgtfqzdt-yssugppcsa-m
- molecular-weight:
- 624.692