Difference between revisions of "PWY-7693"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXALATE OXALATE] == * common-name: ** oxalate * smiles: ** c([o-])(c(=o)[o-])=o * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17371 CPD-17371] == * common-name: ** 18-hydroxylinoleoyl-coa * smiles: ** cc(c)(c(o)c(=o)n...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17371 CPD-17371] == |
* common-name: | * common-name: | ||
− | ** | + | ** 18-hydroxylinoleoyl-coa |
* smiles: | * smiles: | ||
− | ** c([o-])(c(= | + | ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccc=cccccco)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** hjegylshikpenr-daxvlclxsa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 1041.936 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-16118]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=18-hydroxylinoleoyl-coa}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hjegylshikpenr-daxvlclxsa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=1041.936}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-17371
- common-name:
- 18-hydroxylinoleoyl-coa
- smiles:
- cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccc=cccccco)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- hjegylshikpenr-daxvlclxsa-j
- molecular-weight:
- 1041.936