Difference between revisions of "PWY-6035"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP-CHOLINE CDP-CHOLINE] == * common-name: ** cdp-choline * smiles: ** c[n+](c)(c)ccop([o-])(=o...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4205 CPD-4205] == * common-name: ** n6-(δ2-isopentenyl)-adenosine 5'-monophosphate *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4205 CPD-4205] == |
* common-name: | * common-name: | ||
| − | ** | + | ** n6-(δ2-isopentenyl)-adenosine 5'-monophosphate |
* smiles: | * smiles: | ||
| − | ** c | + | ** cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop([o-])([o-])=o)o)o))c=nc=23)))c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** duiszflwbaprbr-sdbhatresa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 413.326 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-4311]] |
| − | * [[RXN- | + | * [[RXN-4313]] |
| − | * [[RXN- | + | * [[RXN-4313-CPD-4205/WATER//CPD-15318/CPD-4209.35.]] |
| − | * [[RXN- | + | * [[RXN-4313-CPD-4205/WATER//CPD-16551/CPD-4209.35.]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-4307]] | |
| − | + | * [[RXN-4311]] | |
| − | |||
| − | * [[RXN- | ||
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n6-(δ2-isopentenyl)-adenosine 5'-monophosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=duiszflwbaprbr-sdbhatresa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=413.326}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-4205
- common-name:
- n6-(δ2-isopentenyl)-adenosine 5'-monophosphate
- smiles:
- cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop([o-])([o-])=o)o)o))c=nc=23)))c
- inchi-key:
- duiszflwbaprbr-sdbhatresa-l
- molecular-weight:
- 413.326
Reaction(s) known to consume the compound
- RXN-4311
- RXN-4313
- RXN-4313-CPD-4205/WATER//CPD-15318/CPD-4209.35.
- RXN-4313-CPD-4205/WATER//CPD-16551/CPD-4209.35.
