Difference between revisions of "PWY-6993"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OROTIDINE-5-PHOSPHATE OROTIDINE-5-PHOSPHATE] == * common-name: ** orotidine 5'-phosphate * smil...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-201 CPD-201] == * common-name: ** 4-hydroxybenzoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OROTIDINE-5-PHOSPHATE OROTIDINE-5-PHOSPHATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-201 CPD-201] ==
 
* common-name:
 
* common-name:
** orotidine 5'-phosphate
+
** 4-hydroxybenzoyl-coa
 
* smiles:
 
* smiles:
** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c(c(=o)[o-])=cc(=o)nc(=o)2))
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(c1(=cc=c(o)c=c1))=o)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** kyobshfobaofbf-xvfcmesisa-k
+
** ltvxpvbfjbtnij-tyhxjlicsa-j
 
* molecular-weight:
 
* molecular-weight:
** 365.17
+
** 883.61
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[OROPRIBTRANS-RXN]]
 
* [[OROTPDECARB-RXN]]
 
* [[ORPDC]]
 
* [[ORPRT]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[OROPRIBTRANS-RXN]]
+
* [[RXN-11246]]
* [[ORPRT]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=orotidine 5'-phosphate}}
+
{{#set: common-name=4-hydroxybenzoyl-coa}}
{{#set: inchi-key=inchikey=kyobshfobaofbf-xvfcmesisa-k}}
+
{{#set: inchi-key=inchikey=ltvxpvbfjbtnij-tyhxjlicsa-j}}
{{#set: molecular-weight=365.17}}
+
{{#set: molecular-weight=883.61}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-201

  • common-name:
    • 4-hydroxybenzoyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(c1(=cc=c(o)c=c1))=o)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
  • inchi-key:
    • ltvxpvbfjbtnij-tyhxjlicsa-j
  • molecular-weight:
    • 883.61

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality