Difference between revisions of "LIPASYN-PWY"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMMONIUM AMMONIUM] == * common-name: ** ammonium * smiles: ** [nh4+] * inchi-key: ** qgzkdvfqnn...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALTOTETRAOSE MALTOTETRAOSE] == * common-name: ** maltotetraose * smiles: ** c(c4(oc(oc3(c(oc(o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALTOTETRAOSE MALTOTETRAOSE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** maltotetraose |
* smiles: | * smiles: | ||
| − | ** | + | ** c(c4(oc(oc3(c(oc(oc2(c(oc(oc1(c(oc(o)c(c1o)o)co))c(c2o)o)co))c(c3o)o)co))c(c(o)c4o)o))o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** luewuzlmquobsb-ayqjavfrsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 666.583 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN0-5182]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[ | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[GLYMALTOPHOSPHORYL-RXN]] | |
| − | + | * [[RXN-14281]] | |
| − | + | * [[RXN-14284]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[ | ||
| − | |||
| − | * [[RXN- | ||
| − | * [[RXN- | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=maltotetraose}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=luewuzlmquobsb-ayqjavfrsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=666.583}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite MALTOTETRAOSE
- common-name:
- maltotetraose
- smiles:
- c(c4(oc(oc3(c(oc(oc2(c(oc(oc1(c(oc(o)c(c1o)o)co))c(c2o)o)co))c(c3o)o)co))c(c(o)c4o)o))o
- inchi-key:
- luewuzlmquobsb-ayqjavfrsa-n
- molecular-weight:
- 666.583
