Difference between revisions of "PWY-7221"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LysW-L-glutamate LysW-L-glutamate] == * common-name: ** a [2-aminoadipate carrier protein]-l-gl...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13534 CPD-13534] == * common-name: ** 3-oxopentanoyl-coa * smiles: ** ccc(=o)cc(=o)sccnc(=o...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13534 CPD-13534] == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-oxopentanoyl-coa |
+ | * smiles: | ||
+ | ** ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
+ | * inchi-key: | ||
+ | ** wioqnwtzboqteu-zmhdxicwsa-j | ||
+ | * molecular-weight: | ||
+ | ** 861.604 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-12561]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-12560]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-oxopentanoyl-coa}} |
+ | {{#set: inchi-key=inchikey=wioqnwtzboqteu-zmhdxicwsa-j}} | ||
+ | {{#set: molecular-weight=861.604}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-13534
- common-name:
- 3-oxopentanoyl-coa
- smiles:
- ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- wioqnwtzboqteu-zmhdxicwsa-j
- molecular-weight:
- 861.604