Difference between revisions of "1CMET2-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17355 CPD-17355] == * common-name: ** a [glycerolipid]-docosahexaenoate == Reaction(s) know...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORIBOSYL-ATP PHOSPHORIBOSYL-ATP] == * common-name: ** 1-(5-phospho-β-d-ribosyl)-atp...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17355 CPD-17355] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORIBOSYL-ATP PHOSPHORIBOSYL-ATP] ==
 
* common-name:
 
* common-name:
** a [glycerolipid]-docosahexaenoate
+
** 1-(5-phospho-β-d-ribosyl)-atp
 +
* smiles:
 +
** c(c4(c(c(c(n3(c(c2(=c(n(c1(c(c(c(o1)cop(op(=o)([o-])op(=o)([o-])o)(=o)[o-])o)o))c=n2)n=c3))=n))o4)o)o))op([o-])([o-])=o
 +
* inchi-key:
 +
** rknhjbvbfhdxgr-keohhstqsa-i
 +
* molecular-weight:
 +
** 714.24
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16138]]
+
* [[ATPPHOSPHORIBOSYLTRANS-RXN]]
 +
* [[HISTPRATPHYD-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ADPART]]
 +
* [[ATPPHOSPHORIBOSYLTRANS-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [glycerolipid]-docosahexaenoate}}
+
{{#set: common-name=1-(5-phospho-β-d-ribosyl)-atp}}
 +
{{#set: inchi-key=inchikey=rknhjbvbfhdxgr-keohhstqsa-i}}
 +
{{#set: molecular-weight=714.24}}

Revision as of 09:22, 27 August 2019

Metabolite PHOSPHORIBOSYL-ATP

  • common-name:
    • 1-(5-phospho-β-d-ribosyl)-atp
  • smiles:
    • c(c4(c(c(c(n3(c(c2(=c(n(c1(c(c(c(o1)cop(op(=o)([o-])op(=o)([o-])o)(=o)[o-])o)o))c=n2)n=c3))=n))o4)o)o))op([o-])([o-])=o
  • inchi-key:
    • rknhjbvbfhdxgr-keohhstqsa-i
  • molecular-weight:
    • 714.24

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality