Difference between revisions of "PWY0-1517"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DICARBOXYLIC-ACID-MONOAMIDES DICARBOXYLIC-ACID-MONOAMIDES] == * common-name: ** a monoamide of...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-381 CPD-381] == * common-name: ** (s)-2-hydroxyglutarate * smiles: ** c(=o)([o-])c(o)ccc(=o...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-381 CPD-381] == |
* common-name: | * common-name: | ||
− | ** | + | ** (s)-2-hydroxyglutarate |
+ | * smiles: | ||
+ | ** c(=o)([o-])c(o)ccc(=o)[o-] | ||
+ | * inchi-key: | ||
+ | ** hwxbtnavrsuojr-vkhmyheasa-l | ||
+ | * molecular-weight: | ||
+ | ** 146.099 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[2-HYDROXYGLUTARATE-DEHYDROGENASE-RXN]] |
+ | * [[RXN-16701]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[2-HYDROXYGLUTARATE-DEHYDROGENASE-RXN]] |
+ | * [[RXN-16701]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(s)-2-hydroxyglutarate}} |
+ | {{#set: inchi-key=inchikey=hwxbtnavrsuojr-vkhmyheasa-l}} | ||
+ | {{#set: molecular-weight=146.099}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-381
- common-name:
- (s)-2-hydroxyglutarate
- smiles:
- c(=o)([o-])c(o)ccc(=o)[o-]
- inchi-key:
- hwxbtnavrsuojr-vkhmyheasa-l
- molecular-weight:
- 146.099