Difference between revisions of "PWY-6364"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ZN+2 ZN+2] == * common-name: ** zn2+ * smiles: ** [zn++] * inchi-key: ** ptfcdoflopiggs-uhfffao...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15280 CPD-15280] == * common-name: ** hercynine * smiles: ** c[n+](c)(c)c(cc1(=cnc=n1))c(=o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15280 CPD-15280] == |
* common-name: | * common-name: | ||
| − | ** | + | ** hercynine |
* smiles: | * smiles: | ||
| − | ** [ | + | ** c[n+](c)(c)c(cc1(=cnc=n1))c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** gppytcrvkhuljh-qmmmgpobsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 197.236 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-14430]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=hercynine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=gppytcrvkhuljh-qmmmgpobsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=197.236}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-15280
- common-name:
- hercynine
- smiles:
- c[n+](c)(c)c(cc1(=cnc=n1))c(=o)[o-]
- inchi-key:
- gppytcrvkhuljh-qmmmgpobsa-n
- molecular-weight:
- 197.236
