Difference between revisions of "PWY-6938"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FERRICYTOCHROME-B5 FERRICYTOCHROME-B5] == * common-name: ** a ferricytochrome b5 == Reaction(s)...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13118 CPD-13118] == * common-name: ** gdp-β-l-fucose * smiles: ** cc4(oc(op(op(occ3(c(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13118 CPD-13118] == |
* common-name: | * common-name: | ||
| − | ** | + | ** gdp-β-l-fucose |
| + | * smiles: | ||
| + | ** cc4(oc(op(op(occ3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))([o-])=o)([o-])=o)c(c(c4o)o)o) | ||
| + | * inchi-key: | ||
| + | ** lqebexmhblqmdb-jgqubwhwsa-l | ||
| + | * molecular-weight: | ||
| + | ** 587.33 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[2.4.1.221-RXN]] |
| − | * [[ | + | * [[2.4.1.68-RXN]] |
| − | * [[RXN- | + | * [[GALACTOSIDE-2-L-FUCOSYLTRANSFERASE-RXN]] |
| + | * [[GALACTOSIDE-3-FUCOSYLTRANSFERASE-RXN]] | ||
| + | * [[RXN-9463]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[1.1.1.271-RXN]] | |
| − | * [[1. | + | * [[2.4.1.221-RXN]] |
| − | |||
| − | * [[ | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=gdp-β-l-fucose}} |
| + | {{#set: inchi-key=inchikey=lqebexmhblqmdb-jgqubwhwsa-l}} | ||
| + | {{#set: molecular-weight=587.33}} | ||
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-13118
- common-name:
- gdp-β-l-fucose
- smiles:
- cc4(oc(op(op(occ3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))([o-])=o)([o-])=o)c(c(c4o)o)o)
- inchi-key:
- lqebexmhblqmdb-jgqubwhwsa-l
- molecular-weight:
- 587.33
Reaction(s) known to consume the compound
- 2.4.1.221-RXN
- 2.4.1.68-RXN
- GALACTOSIDE-2-L-FUCOSYLTRANSFERASE-RXN
- GALACTOSIDE-3-FUCOSYLTRANSFERASE-RXN
- RXN-9463
