Difference between revisions of "PWY-7752"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11512 CPD-11512] == * common-name: ** a (2r,3s,4s)-leucoanthocyanidin == Reaction(s) known...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15653 CPD-15653] == * common-name: ** (3r)-hydroxy, 6-cis-tridecenoyl-coa * smiles: ** cccc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11512 CPD-11512] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15653 CPD-15653] ==
 
* common-name:
 
* common-name:
** a (2r,3s,4s)-leucoanthocyanidin
+
** (3r)-hydroxy, 6-cis-tridecenoyl-coa
 +
* smiles:
 +
** ccccccc=cccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** adzjvtnixnsngu-ukoyhulusa-j
 +
* molecular-weight:
 +
** 973.818
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17678]]
+
* [[RXN-14772]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a (2r,3s,4s)-leucoanthocyanidin}}
+
{{#set: common-name=(3r)-hydroxy, 6-cis-tridecenoyl-coa}}
 +
{{#set: inchi-key=inchikey=adzjvtnixnsngu-ukoyhulusa-j}}
 +
{{#set: molecular-weight=973.818}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-15653

  • common-name:
    • (3r)-hydroxy, 6-cis-tridecenoyl-coa
  • smiles:
    • ccccccc=cccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • adzjvtnixnsngu-ukoyhulusa-j
  • molecular-weight:
    • 973.818

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality