Difference between revisions of "PWY-5441"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13118 CPD-13118] == * common-name: ** gdp-β-l-fucose * smiles: ** cc4(oc(op(op(occ3(c(...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9152 CPD-9152] == * common-name: ** 4-chlorocatechol * smiles: ** c1(c=c(c(=cc=1cl)o)o) * i...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13118 CPD-13118] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9152 CPD-9152] ==
 
* common-name:
 
* common-name:
** gdp-β-l-fucose
+
** 4-chlorocatechol
 
* smiles:
 
* smiles:
** cc4(oc(op(op(occ3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))([o-])=o)([o-])=o)c(c(c4o)o)o)
+
** c1(c=c(c(=cc=1cl)o)o)
 
* inchi-key:
 
* inchi-key:
** lqebexmhblqmdb-jgqubwhwsa-l
+
** wwobypkuyodhdg-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 587.33
+
** 144.557
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.4.1.221-RXN]]
 
* [[2.4.1.68-RXN]]
 
* [[GALACTOSIDE-2-L-FUCOSYLTRANSFERASE-RXN]]
 
* [[GALACTOSIDE-3-FUCOSYLTRANSFERASE-RXN]]
 
* [[RXN-9463]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.1.1.271-RXN]]
+
* [[RXN-9912]]
* [[2.4.1.221-RXN]]
+
* [[RXN-9914]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=gdp-β-l-fucose}}
+
{{#set: common-name=4-chlorocatechol}}
{{#set: inchi-key=inchikey=lqebexmhblqmdb-jgqubwhwsa-l}}
+
{{#set: inchi-key=inchikey=wwobypkuyodhdg-uhfffaoysa-n}}
{{#set: molecular-weight=587.33}}
+
{{#set: molecular-weight=144.557}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-9152

  • common-name:
    • 4-chlorocatechol
  • smiles:
    • c1(c=c(c(=cc=1cl)o)o)
  • inchi-key:
    • wwobypkuyodhdg-uhfffaoysa-n
  • molecular-weight:
    • 144.557

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality