Difference between revisions of "PWY-5490"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11408 CPD-11408] == * common-name: ** triiodothyronine sulfate * smiles: ** c2(c=c(os(=o)(=...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIPHTINE DIPHTINE] == * common-name: ** a diphthine-[translation elongation factor 2] == Reacti...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11408 CPD-11408] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIPHTINE DIPHTINE] ==
 
* common-name:
 
* common-name:
** triiodothyronine sulfate
+
** a diphthine-[translation elongation factor 2]
* smiles:
 
** c2(c=c(os(=o)(=o)[o-])c(=cc(oc1(c(=cc(=cc(i)=1)cc(c(=o)[o-])[n+])i))=2)i)
 
* inchi-key:
 
** xbqyqxvjbndcgy-lbprgkrzsa-m
 
* molecular-weight:
 
** 730.028
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[DIPHTINE--AMMONIA-LIGASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10615]]
+
* [[RXN-11373]]
 +
* [[RXN-14326]]
 +
* [[RXN-15776]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=triiodothyronine sulfate}}
+
{{#set: common-name=a diphthine-[translation elongation factor 2]}}
{{#set: inchi-key=inchikey=xbqyqxvjbndcgy-lbprgkrzsa-m}}
 
{{#set: molecular-weight=730.028}}
 

Revision as of 09:22, 27 August 2019

Metabolite DIPHTINE

  • common-name:
    • a diphthine-[translation elongation factor 2]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a diphthine-[translation elongation factor 2" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.