Difference between revisions of "PWY-7436"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYURIDINE DEOXYURIDINE] == * common-name: ** 2'-deoxyuridine * smiles: ** c1(=cn(c(=o)nc(=o)...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-fucose-protein-serine L-fucose-protein-serine] == * common-name: ** a [protein]-3-o-l-fucosyl...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYURIDINE DEOXYURIDINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-fucose-protein-serine L-fucose-protein-serine] ==
 
* common-name:
 
* common-name:
** 2'-deoxyuridine
+
** a [protein]-3-o-l-fucosyl-l-serine
* smiles:
 
** c1(=cn(c(=o)nc(=o)1)c2(cc(o)c(co)o2))
 
* inchi-key:
 
** mxhrcpnrjammim-shyzeuofsa-n
 
* molecular-weight:
 
** 228.204
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[URA-PHOSPH-RXN]]
+
* [[2.4.1.221-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[CYTIDEAM-RXN]]
+
* [[2.4.1.221-RXN]]
* [[RXN-14143]]
 
* [[URA-PHOSPH-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2'-deoxyuridine}}
+
{{#set: common-name=a [protein]-3-o-l-fucosyl-l-serine}}
{{#set: inchi-key=inchikey=mxhrcpnrjammim-shyzeuofsa-n}}
 
{{#set: molecular-weight=228.204}}
 

Revision as of 09:22, 27 August 2019

Metabolite L-fucose-protein-serine

  • common-name:
    • a [protein]-3-o-l-fucosyl-l-serine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein]-3-o-l-fucosyl-l-serine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.