Difference between revisions of "SJ22386"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1G-772 CPD1G-772] == * common-name: ** 6-o-trans-methoxy-mycolyl-trehalose 6-phosphate * smi...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSE-1P GALACTOSE-1P] == * common-name: ** α-d-galactose 1-phosphate * smiles: ** c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1G-772 CPD1G-772] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSE-1P GALACTOSE-1P] ==
 
* common-name:
 
* common-name:
** 6-o-trans-methoxy-mycolyl-trehalose 6-phosphate
+
** α-d-galactose 1-phosphate
 
* smiles:
 
* smiles:
** ccccccccccccccccccccccccccc(c(occ1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)cop([o-])(=o)[o-])o)o)o)))=o)c(o)cccccccccccccccc3(cc3c(c)cccccccccccccccc(oc)c(c)cccccccccccccccccc)
+
** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1)
 
* inchi-key:
 
* inchi-key:
** xlnaxspacrjuad-bzzonohysa-l
+
** hxxfsfrbohsimq-fprjbgldsa-l
 
* molecular-weight:
 
* molecular-weight:
** 1670.535
+
** 258.121
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN1G-1437]]
+
* [[GALACTOKIN-RXN]]
 +
* [[GALACTURIDYLYLTRANS-RXN]]
 +
* [[UTPHEXPURIDYLYLTRANS-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[GALACTOKIN-RXN]]
 +
* [[GALACTURIDYLYLTRANS-RXN]]
 +
* [[UTPHEXPURIDYLYLTRANS-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6-o-trans-methoxy-mycolyl-trehalose 6-phosphate}}
+
{{#set: common-name=α-d-galactose 1-phosphate}}
{{#set: inchi-key=inchikey=xlnaxspacrjuad-bzzonohysa-l}}
+
{{#set: inchi-key=inchikey=hxxfsfrbohsimq-fprjbgldsa-l}}
{{#set: molecular-weight=1670.535}}
+
{{#set: molecular-weight=258.121}}

Revision as of 09:23, 27 August 2019

Metabolite GALACTOSE-1P

  • common-name:
    • α-d-galactose 1-phosphate
  • smiles:
    • c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1)
  • inchi-key:
    • hxxfsfrbohsimq-fprjbgldsa-l
  • molecular-weight:
    • 258.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality