Difference between revisions of "SJ19759"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15425 CPD-15425] == * common-name: ** 6''-o-carbamoylkanamycin a * smiles: ** c([n+])c1(c(o...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-oxo-cerotoyl-ACPs 3-oxo-cerotoyl-ACPs] == * common-name: ** a 3-oxo-cerotoyl-[acp] == Reactio...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15425 CPD-15425] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-oxo-cerotoyl-ACPs 3-oxo-cerotoyl-ACPs] ==
 
* common-name:
 
* common-name:
** 6''-o-carbamoylkanamycin a
+
** a 3-oxo-cerotoyl-[acp]
* smiles:
 
** c([n+])c1(c(o)c(o)c(o)c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)c(o)c([n+])c(o)3))[n+]))
 
* inchi-key:
 
** prwqrpnqdikfbr-noamyhissa-r
 
* molecular-weight:
 
** 531.559
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-10060]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13167]]
+
* [[RXN-10059]]
* [[RXN-15285]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6''-o-carbamoylkanamycin a}}
+
{{#set: common-name=a 3-oxo-cerotoyl-[acp]}}
{{#set: inchi-key=inchikey=prwqrpnqdikfbr-noamyhissa-r}}
 
{{#set: molecular-weight=531.559}}
 

Revision as of 09:23, 27 August 2019

Metabolite 3-oxo-cerotoyl-ACPs

  • common-name:
    • a 3-oxo-cerotoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 3-oxo-cerotoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.