Difference between revisions of "SJ06192"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2030 CPD0-2030] == * common-name: ** glycerophosphoserine * smiles: ** c(o)c(o)cop([o-])(o...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Single-Stranded-DNAs Single-Stranded-DNAs] == * common-name: ** a single stranded dna == Reacti...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2030 CPD0-2030] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Single-Stranded-DNAs Single-Stranded-DNAs] ==
 
* common-name:
 
* common-name:
** glycerophosphoserine
+
** a single stranded dna
* smiles:
 
** c(o)c(o)cop([o-])(occ([n+])c(=o)[o-])=o
 
* inchi-key:
 
** zwzwygmenqvnfu-uhnvwzdzsa-m
 
* molecular-weight:
 
** 258.144
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14136]]
+
* [[RXN0-5021]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN0-4261]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=glycerophosphoserine}}
+
{{#set: common-name=a single stranded dna}}
{{#set: inchi-key=inchikey=zwzwygmenqvnfu-uhnvwzdzsa-m}}
 
{{#set: molecular-weight=258.144}}
 

Revision as of 09:23, 27 August 2019

Metabolite Single-Stranded-DNAs

  • common-name:
    • a single stranded dna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality