Difference between revisions of "SJ08557"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10267 CPD-10267] == * common-name: ** decanoyl-coa * smiles: ** cccccccccc(=o)sccnc(=o)ccnc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15279 CPD-15279] == * common-name: ** γ-l-glutamyl-s-(hercyn-2-yl)-l-cysteine s-oxide...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10267 CPD-10267] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15279 CPD-15279] ==
 
* common-name:
 
* common-name:
** decanoyl-coa
+
** γ-l-glutamyl-s-(hercyn-2-yl)-l-cysteine s-oxide
 
* smiles:
 
* smiles:
** cccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c[n+](c(c(=o)[o-])cc1(=cnc(s(=o)cc(c([o-])=o)nc(=o)ccc([n+])c(=o)[o-])=n1))(c)c
 
* inchi-key:
 
* inchi-key:
** cnkjphsefdpydb-hsjnekgzsa-j
+
** sjhlsluuwibqns-tylceogasa-m
 
* molecular-weight:
 
* molecular-weight:
** 917.754
+
** 460.481
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13615]]
 
* [[RXN-14274]]
 
* [[RXN-9628]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13614]]
+
* [[RXN-14430]]
* [[RXN-14274]]
 
* [[TRANS-2-ENOYL-COA-REDUCTASE-NAD+-RXN-CPD-10267/NAD//T2-DECENOYL-COA/NADH/PROTON.43.]]
 
* [[TRANSENOYLCOARED-RXN-CPD-10267/NADP//T2-DECENOYL-COA/NADPH/PROTON.45.]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=decanoyl-coa}}
+
{{#set: common-name=γ-l-glutamyl-s-(hercyn-2-yl)-l-cysteine s-oxide}}
{{#set: inchi-key=inchikey=cnkjphsefdpydb-hsjnekgzsa-j}}
+
{{#set: inchi-key=inchikey=sjhlsluuwibqns-tylceogasa-m}}
{{#set: molecular-weight=917.754}}
+
{{#set: molecular-weight=460.481}}

Revision as of 09:23, 27 August 2019

Metabolite CPD-15279

  • common-name:
    • γ-l-glutamyl-s-(hercyn-2-yl)-l-cysteine s-oxide
  • smiles:
    • c[n+](c(c(=o)[o-])cc1(=cnc(s(=o)cc(c([o-])=o)nc(=o)ccc([n+])c(=o)[o-])=n1))(c)c
  • inchi-key:
    • sjhlsluuwibqns-tylceogasa-m
  • molecular-weight:
    • 460.481

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality