Difference between revisions of "SJ11871"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOXYL INDOXYL] == * common-name: ** indoxyl * smiles: ** c2(c=cc1(=c(c(o)=cn1)c=2)) * inchi-k...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Fructose-BisPO4-Aldolase-Tri-Me-Lysine Fructose-BisPO4-Aldolase-Tri-Me-Lysine] == * common-name...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Fructose-BisPO4-Aldolase-Tri-Me-Lysine Fructose-BisPO4-Aldolase-Tri-Me-Lysine] == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [fructose-bisphosphate aldolase]-n6, n6,n6-trimethyl-l-lysine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-13588]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [fructose-bisphosphate aldolase]-n6, n6,n6-trimethyl-l-lysine}} |
| − | |||
| − | |||
Revision as of 09:23, 27 August 2019
Contents
Metabolite Fructose-BisPO4-Aldolase-Tri-Me-Lysine
- common-name:
- a [fructose-bisphosphate aldolase]-n6, n6,n6-trimethyl-l-lysine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [fructose-bisphosphate aldolase]-n6, n6,n6-trimethyl-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
