Difference between revisions of "SJ03985"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HEXANOYL-COA HEXANOYL-COA] == * common-name: ** hexanoyl-coa * smiles: ** cccccc(=o)sccnc(=o)cc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Red-NADPH-Hemoprotein-Reductases Red-NADPH-Hemoprotein-Reductases] == * common-name: ** a reduc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HEXANOYL-COA HEXANOYL-COA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Red-NADPH-Hemoprotein-Reductases Red-NADPH-Hemoprotein-Reductases] ==
 
* common-name:
 
* common-name:
** hexanoyl-coa
+
** a reduced [nadph-hemoprotein reductase]
* smiles:
 
** cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** oexfmsfodmqepe-hdrqghtbsa-j
 
* molecular-weight:
 
** 861.647
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.1.2.19-RXN-HEXANOYL-COA/WATER//HEXANOATE/CO-A/PROTON.42.]]
+
* [[HEME-OXYGENASE-DECYCLIZING-RXN]]
* [[ACECOATRANS-RXN-HEXANOYL-COA/ACET//HEXANOATE/ACETYL-COA.40.]]
+
* [[RXN-11056]]
* [[RXN-14277]]
+
* [[RXN-11057]]
* [[RXN-14278]]
+
* [[RXN-13064]]
* [[THIOESTER-RXN[CCO-CYTOSOL]-HEXANOYL-COA/WATER//HEXANOATE/CO-A/PROTON.55.]]
+
* [[RXN-17625]]
 +
* [[RXN-17627]]
 +
* [[RXN-8630]]
 +
* [[RXN-8872]]
 +
* [[RXN66-146]]
 +
* [[RXN66-161]]
 +
* [[RXN66-163]]
 +
* [[RXN66-169]]
 +
* [[RXN66-181]]
 +
* [[SQUALENE-MONOOXYGENASE-RXN]]
 +
* [[UNSPECIFIC-MONOOXYGENASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12559]]
+
* [[RXN-17627]]
* [[RXN-14277]]
 
* [[RXN-14278]]
 
* [[TRANSENOYLCOARED-RXN-HEXANOYL-COA/NADP//CPD0-2121/NADPH/PROTON.42.]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=hexanoyl-coa}}
+
{{#set: common-name=a reduced [nadph-hemoprotein reductase]}}
{{#set: inchi-key=inchikey=oexfmsfodmqepe-hdrqghtbsa-j}}
 
{{#set: molecular-weight=861.647}}
 

Revision as of 09:23, 27 August 2019

Metabolite Red-NADPH-Hemoprotein-Reductases

  • common-name:
    • a reduced [nadph-hemoprotein reductase]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a reduced [nadph-hemoprotein reductase" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.