Difference between revisions of "SJ09282"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9956 CPD-9956] == * common-name: ** ubiquinol-8 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HEXANOYL-COA HEXANOYL-COA] == * common-name: ** hexanoyl-coa * smiles: ** cccccc(=o)sccnc(=o)cc...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HEXANOYL-COA HEXANOYL-COA] == |
* common-name: | * common-name: | ||
− | ** | + | ** hexanoyl-coa |
* smiles: | * smiles: | ||
− | ** | + | ** cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** oexfmsfodmqepe-hdrqghtbsa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 861.647 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[3.1.2.19-RXN-HEXANOYL-COA/WATER//HEXANOATE/CO-A/PROTON.42.]] |
− | * [[ | + | * [[ACECOATRANS-RXN-HEXANOYL-COA/ACET//HEXANOATE/ACETYL-COA.40.]] |
+ | * [[RXN-14277]] | ||
+ | * [[RXN-14278]] | ||
+ | * [[THIOESTER-RXN[CCO-CYTOSOL]-HEXANOYL-COA/WATER//HEXANOATE/CO-A/PROTON.55.]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-12559]] |
− | * [[ | + | * [[RXN-14277]] |
− | * [[ | + | * [[RXN-14278]] |
+ | * [[TRANSENOYLCOARED-RXN-HEXANOYL-COA/NADP//CPD0-2121/NADPH/PROTON.42.]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=hexanoyl-coa}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=oexfmsfodmqepe-hdrqghtbsa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=861.647}} |
Revision as of 09:23, 27 August 2019
Contents
Metabolite HEXANOYL-COA
- common-name:
- hexanoyl-coa
- smiles:
- cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- oexfmsfodmqepe-hdrqghtbsa-j
- molecular-weight:
- 861.647
Reaction(s) known to consume the compound
- 3.1.2.19-RXN-HEXANOYL-COA/WATER//HEXANOATE/CO-A/PROTON.42.
- ACECOATRANS-RXN-HEXANOYL-COA/ACET//HEXANOATE/ACETYL-COA.40.
- RXN-14277
- RXN-14278
- [[THIOESTER-RXN[CCO-CYTOSOL]-HEXANOYL-COA/WATER//HEXANOATE/CO-A/PROTON.55.]]