Difference between revisions of "SJ21677"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UROCANATE UROCANATE] == * common-name: ** urocanate * smiles: ** c1(nc=nc=1c=cc([o-])=o) * inch...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MPBQ MPBQ] == * common-name: ** 2-methyl-6-phytyl-1,4-benzoquinol * smiles: ** cc(cccc(cccc(c)c...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MPBQ MPBQ] == |
* common-name: | * common-name: | ||
− | ** | + | ** 2-methyl-6-phytyl-1,4-benzoquinol |
* smiles: | * smiles: | ||
− | ** | + | ** cc(cccc(cccc(c)cccc(c)=ccc1(c=c(o)c=c(c)c(o)=1))c)c |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** gtwcnyrfozkwtl-uofxaseasa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 402.659 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-2542]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-2541]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=2-methyl-6-phytyl-1,4-benzoquinol}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=gtwcnyrfozkwtl-uofxaseasa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=402.659}} |
Revision as of 09:23, 27 August 2019
Contents
Metabolite MPBQ
- common-name:
- 2-methyl-6-phytyl-1,4-benzoquinol
- smiles:
- cc(cccc(cccc(c)cccc(c)=ccc1(c=c(o)c=c(c)c(o)=1))c)c
- inchi-key:
- gtwcnyrfozkwtl-uofxaseasa-n
- molecular-weight:
- 402.659